mahrahajjaj
mahrahajjaj
03-12-2017
Mathematics
contestada
Which answer is right
Respuesta :
Аноним
Аноним
03-12-2017
that would be 10 1/4 * 2/ 1/2
= 41/4 * 5/2 = 205/8 = 25 inches approximately
Answer is C
Answer Link
VER TODAS LAS RESPUESTAS ( 81+ )
Otras preguntas
Solve for x: |3x + 12| = 18 (5 points) A. x = 2, x = −10 B. x = 2, x = −2 C. x = 10, x = −10 D. x = −2, x = 10
Vroom's expectancy theory contends that prior to committing maximum effort to a task, employees want to know if they can accomplish the task and if it will equa
At the national level, what is a disadvantage of being in the party that opposes the President’s party?
If the Fed increases the discount rate, which of the following accurately describes the sequence of events that will follow in the banking system, finally leadi
Name the following compound from the concise formula:______. CH3CH(CH3)CHCHCH(CH3)CH2CH3 A. 2,4-dimethyl-3-heptene B. 2,5-dimethyl-3-heptene C. 3,5-dimethyl
Bob sells a car to Fred but Bob fails to mention that he disconnected the odometer, which reads 39,000 miles. Bob disconnected the odometer 20,000 miles ago. Wh
Between 1920 and 1940,the quest for racial equality and a search for self-identity among African-Americans inspired the ________,an upsurge of creative expressi
Q9 A physics book slides off a horizontal tabletop with a speed of 1.10 m/s. It strikes the floor in 0.350s. ignore air resistance. Find (a) the height of the t
Identify each of the following characteristics or descriptions as Lycopodium sp. or Selaginella sp., using the following key. (Both may apply to some characteri
6 sqrt (x-2) +4 < 28 How do you solve? Btw.. x-2 is under sqrt sign.
